BIOPEP-UWM: Report
| ID | 9361 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 379.4495 | Monoisotopic mass | 379.2100 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tian M., Fang B., Jiang L., Guo H., Cui J., Ren F. | |
| Title | |
| Structure-activity relationship of a series of antioxidant tripeptides derived from β-lactoglobulin using QSAR modeling. Dairy Science and Technology (2015) 95:451–463. | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(C(C)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(C(C)C)C(O)=O InChI= 1S/C19H29N3O5/c1-10(2)15(20)18(25)21-14(9-12-5-7-13(23)8-6-12)17(24)22-16(11(3)4)19(26)27/h5-8,10-11,14-16,23H,9,20H2,1-4H3,(H,21,25)(H,22,24)(H,26,27)/t14-,15-,16-/m0/s1 InChIKey: ZNGPROMGGGFOAA-JYJNAYRXSA-N Relative antioxidative activity was: 15.38 mmol Fe/mol peptide |
| Database reference: |
| BRENDA: Ligand Val-Tyr-Val ChEBI: ID 75022 ChemSpider: ID 5378742 PubChem: CID 7015709 ZINC: ID ZINC02516170 |