BIOPEP-UWM: Report
| ID | 9375 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 542.5811 | Monoisotopic mass | 542.2691 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Villegas J. M., Picariello G., Mamone G., Espeche Turbay M. B., Savoy de Giori G., Hebert E. M. | |
| Title | |
| Milk-derived angiotensin-I-converting enzyme-inhibitory peptides generated by Lactobacillus delbrueckii subsp. lactis CRL 581. Peptidomics 1: 22–29, 2014. | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCC(O)=O)(NC(=O)[C@]([H])(CCC(N)=O)NC(=O)[C@]1([H])CCCN1C(=O)[C@]([H])(CC(C)C)NC(=O)CN)C(O)=O InChI=1S/C23H38N6O9/c1-12(2)10-15(26-18(31)11-24)22(36)29-9-3-4-16(29)21(35)27-13(5-7-17(25)30)20(34)28-14(23(37)38)6-8-19(32)33/h12-16H,3-11,24H2,1-2H3,(H2,25,30)(H,26,31)(H,27,35)(H,28,34)(H,32,33)(H,37,38)/t13-,14-,15-,16-/m0/s1 InChIKey: ZNJDWZKNMXZUFI-VGWMRTNUSA-N |
| Database reference: |