BIOPEP-UWM: Report
| ID | 9386 |
| Name | Immunostimulating peptide |
| sequence |
| Function: | |||
| Innunostimulating | |||
| Number of residues | 3 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 335.3971 | Monoisotopic mass | 335.1839 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Berthou J, Migliore-Samour D, Lifchitz A, Delettré J, Floc'h F, Jollès P. | |
| Title | |
| Immunostimulating properties and three dimentional structure of two tripeptides from human and cow caseins. FEBS Letters, 218, 55-58, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CC(C)C)(NC(=O)CN)C(=O)N[C@@]([H])(Cc1ccccc1)C(O)=O InChI=1S/C17H25N3O4/c1-11(2)8-13(19-15(21)10-18)16(22)20-14(17(23)24)9-12-6-4-3-5-7-12/h3-7,11,13-14H,8-10,18H2,1-2H3,(H,19,21)(H,20,22)(H,23,24)/t13-,14-/m0/s1 InChIKey=TVUWMSBGMVAHSJ-KBPBESRZSA-N fr: 51-53 of human and bovine alpha-lactalbumin Peptide regulating phosphoinositol metabolism according to the BIOPEP-UWM database of bioactive peptides (ID 2740) |
| Database reference: |
| ACToR: ID 103213-38-3 BindingDB: ID 50188525 BIOPEP-UWM database of bioactive peptides: ID 2740 ChEMBL: ID CHEMBL209670 ChemIDplus: ID 103213383 ChemSpider: ID 113733 EROP-Moscow: ID E01883 J-GLOBAL: ID 200907092951841791 Nikkaji: ID J492.337E PubChem: CID 128287 SureChEMBL: ID SCHEMBL4281374 ZINC: ID ZINC000002522593 |