BIOPEP-UWM: Report
ID | 9388 |
Name | Alpha-glucosidase inhibitor |
sequence |
Function: | |||
Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
Number of residues | 4 |
Activity code | glui |
Activity : | alpha-glucosidase inhibitor |
|||
Chemical mass | 554.6331 | Monoisotopic mass | 554.2731 | |
EC50 : | 3700.00 µM |
Bibliographic data: | |
Authors | |
Matsui T., Oki T., Osajima Y. | |
Title | |
Isolation and identification of peptidic α-glucosidase inhibitors derived from sardine muscle hydrolyzate. Z Naturforsch C 54:259–263 (1999) | |
Year | Source |
1999 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C29H38N4O7/c1-17(2)14-24(29(39)40)32-27(37)25-4-3-13-33(25)28(38)23(16-19-7-11-21(35)12-8-19)31-26(36)22(30)15-18-5-9-20(34)10-6-18/h5-12,17,22-25,34-35H,3-4,13-16,30H2,1-2H3,(H,31,36)(H,32,37)(H,39,40)/t22-,23-,24-,25-/m0/s1 InChIKey=NJNVLDLDKMFYLW-QORCZRPOSA-N |
Database reference: |
ChemSpider: ID 8523091 PubChem: CID 10347633 |