BIOPEP-UWM: Report
| ID | 9395 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 5 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 582.6052 | Monoisotopic mass | 582.2753 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yu Z, Yin Y, Zhao W, Yu Y, Liu B, Liu J, Chen F | |
| Title | |
| Novel peptides derived from egg white protein inhibiting alpha-glucosidase. Food Chem 129:1376–1382 (2011) | |
| Year | Source |
| 2011 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1cnc[nH]1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N[C@@]([H])(CC(N)=O)C(O)=O InChI=1S/C24H38N8O9/c1-4-11(2)19(23(39)31-16(24(40)41)8-17(26)33)32-22(38)15(5-6-18(34)35)30-20(36)12(3)29-21(37)14(25)7-13-9-27-10-28-13/h9-12,14-16,19H,4-8,25H2,1-3H3,(H2,26,33)(H,27,28)(H,29,37)(H,30,36)(H,31,39)(H,32,38)(H,34,35)(H,40,41)/t11-,12-,14-,15-,16-,19-/m0/s1 InChIKey=WRHNPYUHAVYASD-XTPDHVNNSA-N Originally, IC50 (µM) of peptide was >150 (see cited paper). Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database |
| Database reference: |
| AHTPDB: ID 4483 BioPepDB: ID biopep00443 SATPdb: ID satpdb10255 |