BIOPEP-UWM: Report
| ID | 9399 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 496.5558 | Monoisotopic mass | 496.2637 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Moayedi A., Mora L., Aristoy M. C., Safari M., Hashemi M., Toldra F. | |
| Title | |
| Peptidomic analysis of antioxidant and ACE-inhibitory peptides obtained from tomato waste proteins fermented using Bacillus subtilis. Food Chemistry 250 (2018), 180-187. | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C22H36N6O7/c1-12(2)18(26-19(31)13(7-8-16(24)29)25-17(30)11-23)21(33)27-9-3-5-14(27)20(32)28-10-4-6-15(28)22(34)35/h12-15,18H,3-11,23H2,1-2H3,(H2,24,29)(H,25,30)(H,26,31)(H,34,35)/t13-,14-,15-,18-/m0/s1 InChIKey: MOINKWWSYQLUNZ-XSWJXKHESA-N Shows a 97% of DPPH-scavenging activity at 0.4 mM. |
| Database reference: |