BIOPEP-UWM: Report
| ID | 9401 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 5 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 503.5451 | Monoisotopic mass | 503.2582 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yu Z, Yin Y, Zhao W, Yu Y, Liu B, Liu J, Chen F | |
| Title | |
| Novel peptides derived from egg white protein inhibiting alpha-glucosidase. Food Chem 129:1376–1382 (2011) | |
| Year | Source |
| 2011 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCC(O)=O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CO)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C21H37N5O9/c1-10(2)7-13(21(34)35)24-15(28)8-23-19(32)14(9-27)25-20(33)17(11(3)4)26-18(31)12(22)5-6-16(29)30/h10-14,17,27H,5-9,22H2,1-4H3,(H,23,32)(H,24,28)(H,25,33)(H,26,31)(H,29,30)(H,34,35)/t12-,13-,14-,17-/m0/s1 InChIKey: QIYLEYLYIUCHRF-WSMBLCCSSA-N Originally, IC50 (µM) of peptide was >150 (see cited paper). |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9413 |