BIOPEP-UWM: Report
| ID | 9405 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 6 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 656.7264 | Monoisotopic mass | 656.3482 | |
| IC50 : | 100.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yu Z, Yin Y, Zhao W, Yu Y, Liu B, Liu J, Chen F | |
| Title | |
| Novel peptides derived from egg white protein inhibiting alpha-glucosidase. Food Chem 129:1376–1382 (2011) | |
| Year | Source |
| 2011 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(N)=O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CO)C(O)=O InChI=1S/C28H48N8O10/c1-13(2)10-17(33-26(43)22(14(3)4)35-23(40)15(29)11-21(31)39)24(41)32-16(7-8-20(30)38)27(44)36-9-5-6-19(36)25(42)34-18(12-37)28(45)46/h13-19,22,37H,5-12,29H2,1-4H3,(H2,30,38)(H2,31,39)(H,32,41)(H,33,43)(H,34,42)(H,35,40)(H,45,46)/t15-,16-,17-,18-,19-,22-/m0/s1 InChIKey=SWFKLPXLBLGJPL-LXYCOOOUSA-N Inhibitor of alpha-amylase (EC 3.2.1.1) according to the BIOPEP-UWM database of bioactive peptides (ID 9417) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9417 |