BIOPEP-UWM: Report
| ID | 9406 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 6 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 731.8341 | Monoisotopic mass | 731.3841 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yu Z, Yin Y, Zhao W, Yu Y, Liu B, Liu J, Chen F | |
| Title | |
| Novel peptides derived from egg white protein inhibiting alpha-glucosidase. Food Chem 129:1376–1382 (2011) | |
| Year | Source |
| 2011 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(Cc1ccccc1)C(O)=O InChI=1S/C35H53N7O10/c1-5-20(4)29(33(49)39-24(18-27(37)43)31(47)40-25(35(51)52)17-21-10-7-6-8-11-21)41-32(48)26-12-9-15-42(26)34(50)23(13-14-28(44)45)38-30(46)22(36)16-19(2)3/h6-8,10-11,19-20,22-26,29H,5,9,12-18,36H2,1-4H3,(H2,37,43)(H,38,46)(H,39,49)(H,40,47)(H,41,48)(H,44,45)(H,51,52)/t20-,22-,23-,24-,25-,26-,29-/m0/s1 InChIKey=FMWASPQBXFXMLS-YGDYRFLNSA-N Originally, IC50 (µM) of peptide was >150 (see cited paper). Inhibitor of alpha-amylase (EC 3.2.1.1) according to the BIOPEP-UWM database of bioactive peptides (ID 9418) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9418 |