BIOPEP-UWM: Report
| ID | 9409 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 8 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 926.0639 | Monoisotopic mass | 925.4893 | |
| EC50 : | 2500.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Uenishi H, Kabuki T, Seto Y, Serizawa A, Nakajima H | |
| Title | |
| Isolation and identification of casein-derived dipeptidyl-peptidase 4 (DPP-4)-inhibitory peptide LPQNIPPL from goudatype cheese and its effect on plasma glucose in rats. Int Dairy J (2012) 22:24–30 | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(C(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCC(O)=O)C(O)=O InChI=1S/C45H67N9O12/c1-5-26(4)37(41(61)48-28(17-19-34(46)55)42(62)52-21-9-14-31(52)39(59)49-29(45(65)66)18-20-35(56)57)51-38(58)30(24-27-12-7-6-8-13-27)50-40(60)32-15-10-22-53(32)43(63)33-16-11-23-54(33)44(64)36(47)25(2)3/h6-8,12-13,25-26,28-33,36-37H,5,9-11,14-24,47H2,1-4H3,(H2,46,55)(H,48,61)(H,49,59)(H,50,60)(H,51,58)(H,56,57)(H,65,66)/t26-,28-,29-,30-,31-,32-,33-,36-,37-/m0/s1 InChIKey=XZFCCNOVLLEABC-VPGCIKRGSA-N |
| Database reference: |