BIOPEP-UWM: Report
| ID | 9410 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 9 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 1002.1168 | Monoisotopic mass | 1001.4842 | |
| EC50 : | 670.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Uenishi H, Kabuki T, Seto Y, Serizawa A, Nakajima H | |
| Title | |
| Isolation and identification of casein-derived dipeptidyl-peptidase 4 (DPP-4)-inhibitory peptide LPQNIPPL from goudatype cheese and its effect on plasma glucose in rats. Int Dairy J (2012) 22:24–30 | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N1CCC[C@@]1([H])C(=O)NCC(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(O)=O)C(O)=O InChI=1S/C50H67N9O13/c1-3-29(2)42(49(70)59-24-10-16-39(59)45(66)54-35(50(71)72)27-41(62)63)55-46(67)37-14-7-21-56(37)40(61)28-52-43(64)36-13-8-23-58(36)48(69)34(26-30-11-5-4-6-12-30)53-44(65)38-15-9-22-57(38)47(68)33(51)25-31-17-19-32(60)20-18-31/h4-6,11-12,17-20,29,33-39,42,60H,3,7-10,13-16,21-28,51H2,1-2H3,(H,52,64)(H,53,65)(H,54,66)(H,55,67)(H,62,63)(H,71,72)/t29-,33-,34-,35-,36-,37-,38-,39-,42-/m0/s1 InChIKey=WHUMHCNDCNAHPK-UDZSMLTASA-N |
| Database reference: |