BIOPEP-UWM: Report
| ID | 9412 |
| Name | Alpha-amylase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-amylase (EC 3.2.1.1) | |||
| Number of residues | 5 |
Activity code | aami |
| Activity : | alpha-amylase inhibitor |
|||
| Chemical mass | 560.6838 | Monoisotopic mass | 560.3312 | |
| IC50 : | 120.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yu Z, Yin Y, Zhao W, Liu J, Chen F | |
| Title | |
| Anti-diabetic activity peptides from albumin against α-glucosidase and α-amylase. Food Chem 135:2078–2085 (2012) | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)NCC(=O)N[C@@]([H])(Cc1ccccc1)C(O)=O InChI=1S/C28H44N6O6/c1-18(2)15-21(33-25(36)20(30)11-6-7-13-29)27(38)34-14-8-12-23(34)26(37)31-17-24(35)32-22(28(39)40)16-19-9-4-3-5-10-19/h3-5,9-10,18,20-23H,6-8,11-17,29-30H2,1-2H3,(H,31,37)(H,32,35)(H,33,36)(H,39,40)/t20-,21-,22-,23-/m0/s1 InChIKey=GWJRAPPCHUBQTC-MLCQCVOFSA-N Inhibitor of alpha-glucosidase (EC 3.2.1.20) according to the BIOPEP-UWM database of bioactive peptides (ID 9400) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9400 |