BIOPEP-UWM: Report
| ID | 9422 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 660.6722 | Monoisotopic mass | 660.3068 | |
| IC50 : | 73.25 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ni H., Li L. , Guo S.-S. , Li H.-H., Jiang R., Hu S.-Q. | |
| Title | |
| Isolation and Identification of an Angiotensin-I Converting Enzyme Inhibitory Peptide from Yeast (Saccharomyces cerevisiae). Current Analytical Chemistry, 2012, 8, 180-185 | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(N)C(=O)N1CCC[C@@]1([H])C(=O)N[C@]([H])(C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(CO)C(O)=O)[C@@]([H])(C)O InChI=1S/C26H44N8O12/c1-11(36)19(29)25(44)34-9-3-4-16(34)23(42)33-20(12(2)37)24(43)31-14(6-8-18(28)39)21(40)30-13(5-7-17(27)38)22(41)32-15(10-35)26(45)46/h11-16,19-20,35-37H,3-10,29H2,1-2H3,(H2,27,38)(H2,28,39)(H,30,40)(H,31,43)(H,32,41)(H,33,42)(H,45,46)/t11-,12-,13+,14+,15+,16+,19+,20+/m1/s1 InChIKey=QPGOKERSRKFQTI-CILRADMLSA-N |
| Database reference: |