BIOPEP-UWM: Report
| ID | 9425 |
| Name | Antibacterial peptide |
| sequence |
| Function: | |||
| Antibacterial | |||
| Number of residues | 9 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 985.0962 | Monoisotopic mass | 984.5449 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ennaas N., Hammami R., Beaulieu L., Fliss I. | |
| Title | |
| Purification and characterization of four antibacterial peptides from protamex hydrolysate of Atlantic mackerel (Scomber scombrus) by-products. Biochem. Biophys. Res. Commun., 462(3), 195-200, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CO)C(=O)NCC(=O)N[C@@]([H])(CC(O)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N[C@@]([H])(CCCNC(N)=N)C(O)=O InChI=1S/C40H72N16O13/c1-21(2)16-25(33(63)49-18-29(58)51-24(38(68)69)10-6-14-48-40(45)46)54-36(66)28-11-7-15-56(28)37(67)26(17-31(60)61)52-30(59)19-50-34(64)27(20-57)55-35(65)23(9-3-4-12-41)53-32(62)22(42)8-5-13-47-39(43)44/h21-28,57H,3-20,41-42H2,1-2H3,(H,49,63)(H,50,64)(H,51,58)(H,52,59)(H,53,62)(H,54,66)(H,55,65)(H,60,61)(H,68,69)(H4,43,44,47)(H4,45,46,48)/t22-,23-,24-,25-,26-,27-,28-/m0/s1 InChIKey: AYJLIZGJFYAZKI-RMIXPHLWSA-N |
| Database reference: |