BIOPEP-UWM: Report
| ID | 9430 |
| Name | Renin inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Renin (EC 3.4.23.15) (MEROPS ID A01.007) | |||
| Number of residues | 2 |
Activity code | ren |
| Activity : | renin inhibitor |
|||
| Chemical mass | 288.3028 | Monoisotopic mass | 288.1542 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Udenigwe C.; Li H.; Aluko R. | |
| Title | |
| Quantitative structure-activity relationship modeling of renin-inhibiting dipeptides. Amino Acids, 42, 1379–1386, 2012 | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C10H20N6O4/c11-5(4-7(12)17)8(18)16-6(9(19)20)2-1-3-15-10(13)14/h5-6H,1-4,11H2,(H2,12,17)(H,16,18)(H,19,20)(H4,13,14,15)/t5-,6-/m0/s1 InChIKey: NPDLYUOYAGBHFB-WDSKDSINSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8849) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 8849 ChemSpider: ID 67030463 PubChem: CID 14299174 SureChEMBL: ID SCHEMBL9852051 |