BIOPEP-UWM: Report
| ID | 9434 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 586.7470 | Monoisotopic mass | 586.3251 | |
| IC50 : | 175.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wu S., Feng X., Lan X., Xu Y., Liao D. | |
| Title | |
| Purification and identification of Angiotensin-I Converting Enzyme (ACE) inhibitory peptide from lizard fish (Saurida elongata) hydrolysate. J. Funct. Foods, 13, 295-299 (2015) | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C25H46N8O6S/c1-13(2)11-16(23(37)33-10-6-8-18(33)24(38)39)30-21(35)17(12-40)31-22(36)19(14(3)4)32-20(34)15(26)7-5-9-29-25(27)28/h13-19,40H,5-12,26H2,1-4H3,(H,30,35)(H,31,36)(H,32,34)(H,38,39)(H4,27,28,29)/t15-,16-,17-,18-,19-/m0/s1 InChIKey: BIYLPYGMGOUNEQ-VMXHOPILSA-N |
| Database reference: |