BIOPEP-UWM: Report
| ID | 9437 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 7 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 728.8747 | Monoisotopic mass | 728.4418 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zielińska E., Baraniak B., Karaś M. | |
| Title | |
| Identification of antioxidant and anti-inflammatory peptides obtained by simulated gastrointestinal digestion of three edible insects species (Gryllodes sigillatus, Tenebrio molitor, Schistocerca gragaria). Int. J. Food Sci. Technol., 53, 2542-2551, | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C33H60N8O10/c1-7-18(4)25(30(47)37-22(33(50)51)11-8-9-13-34)39-31(48)26(20(6)43)40-28(45)23(16-42)38-29(46)24-12-10-14-41(24)32(49)19(5)36-27(44)21(35)15-17(2)3/h17-26,42-43H,7-16,34-35H2,1-6H3,(H,36,44)(H,37,47)(H,38,46)(H,39,48)(H,40,45)(H,50,51)/t18-,19-,20+,21-,22-,23-,24-,25-,26-/m0/s1 InChIKey= RZGYKXWBKAWARZ-VOPNCDMXSA-N |
| Database reference: |