BIOPEP-UWM: Report
| ID | 9442 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1081.0894 | Monoisotopic mass | 1080.4497 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zielińska E., Baraniak B., Karaś M. | |
| Title | |
| Identification of antioxidant and anti-inflammatory peptides obtained by simulated gastrointestinal digestion of three edible insects species (Gryllodes sigillatus, Tenebrio molitor, Schistocerca gragaria). Int. J. Food Sci. Technol., 53, 2542-2551, | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)O InChI=1S/C48H64N12O17/c49-14-2-1-4-31(47(75)60-15-3-5-37(60)46(74)59-35(48(76)77)18-27-21-51-24-53-27)55-43(71)32(17-26-8-12-29(63)13-9-26)57-45(73)36(23-61)54-38(64)22-52-42(70)33(19-39(65)66)58-44(72)34(20-40(67)68)56-41(69)30(50)16-25-6-10-28(62)11-7-25/h6-13,21,24,30-37,61-63H,1-5,14-20,22-23,49-50H2,(H,51,53)(H,52,70)(H,54,64)(H,55,71)(H,56,69)(H,57,73)(H,58,72)(H,59,74)(H,65,66)(H,67,68)(H,76,77)/t30-,31-,32-,33-,34-,35-,36-,37-/m0/s1 InChIKey= YYAFFTNFHUOXAT-MDKUUQCZSA-N |
| Database reference: |