BIOPEP-UWM: Report
| ID | 9447 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 880.9392 | Monoisotopic mass | 880.4276 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zielińska E., Baraniak B., Karaś M. | |
| Title | |
| Identification of antioxidant and anti-inflammatory peptides obtained by simulated gastrointestinal digestion of three edible insects species (Gryllodes sigillatus, Tenebrio molitor, Schistocerca gragaria). Int. J. Food Sci. Technol., 53, 2542-2551, | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)NCC(=O)N[C@@]([H])(CC(=O)N)C(=O)NCC(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C38H60N10O14/c1-4-19(2)31(37(60)46-25(38(61)62)7-5-6-14-39)47-29(53)18-42-34(57)26(16-27(41)51)44-28(52)17-43-36(59)32(20(3)49)48-35(58)24(12-13-30(54)55)45-33(56)23(40)15-21-8-10-22(50)11-9-21/h8-11,19-20,23-26,31-32,49-50H,4-7,12-18,39-40H2,1-3H3,(H2,41,51)(H,42,57)(H,43,59)(H,44,52)(H,45,56)(H,46,60)(H,47,53)(H,48,58)(H,54,55)(H,61,62)/t19-,20+,23-,24-,25-,26-,31-,32-/m0/s1 InChIKey= ZBGYYJXTWBVMEG-TZCYLVGHSA-N |
| Database reference: |