BIOPEP-UWM: Report
| ID | 9449 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 701.8065 | Monoisotopic mass | 701.3946 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu B., Aisa H. A., Yili A. | |
| Title | |
| Isolation and identifcation of two potential antioxidant peptides from sheep abomasum protein hydrolysates. Eur. Food Res. Technol. 244, 1615–1625 (2018) | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(CC)[C@]([H])(N)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C31H55N7O11/c1-7-17(6)24(33)29(46)36-20(13-22(39)40)27(44)35-21(14-23(41)42)28(45)38-25(16(4)5)30(47)37-19(12-15(2)3)26(43)34-18(31(48)49)10-8-9-11-32/h15-21,24-25H,7-14,32-33H2,1-6H3,(H,34,43)(H,35,44)(H,36,46)(H,37,47)(H,38,45)(H,39,40)(H,41,42)(H,48,49)/t17-,18-,19-,20-,21-,24-,25-/m0/s1 InChIKey: ZGALEBBNHYRROQ-YMKPZFJOSA-N |
| Database reference: |