BIOPEP-UWM: Report
| ID | 9453 |
| Name | Antifungal peptide |
| sequence |
| Function: | |||
| Antifungal | |||
| Number of residues | 12 |
Activity code | af |
| Activity : | antifungal |
|||
| Chemical mass | 1253.4238 | Monoisotopic mass | 1252.5891 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Muhialdin B. J., Hassan Z., Bakar F. A., Saari N. | |
| Title | |
| Identification of antifungal peptides produced by Lactobacillus plantarum IS10 grown in the MRS broth. Food Control, 59, 27-30, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@]([H])(CO)NC(=O)[C@]1([H])CCCN1C(=O)[C@@]([H])(N)Cc1ccccc1)C(=O)NCC(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(C(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C57H84N14O16S/c1-31(2)45(56(85)70-21-10-16-42(70)54(83)69-20-9-15-41(69)55(84)71-22-11-17-43(71)57(86)87)66-50(79)39(29-73)64-47(76)36(18-23-88-4)62-44(75)27-60-52(81)46(32(3)74)67-48(77)37(25-34-26-59-30-61-34)63-49(78)38(28-72)65-51(80)40-14-8-19-68(40)53(82)35(58)24-33-12-6-5-7-13-33/h5-7,12-13,26,30-32,35-43,45-46,72-74H,8-11,14-25,27-29,58H2,1-4H3,(H,59,61)(H,60,81)(H,62,75)(H,63,78)(H,64,76)(H,65,80)(H,66,79)(H,67,77)(H,86,87)/t32-,35+,36+,37+,38+,39+,40+,41+,42+,43+,45+,46+/m1/s1 InChIKey: TUWYCULLLIPJGS-QNJCORJGSA-N |
| Database reference: |