BIOPEP-UWM: Report
| ID | 9455 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1164.2938 | Monoisotopic mass | 1163.4143 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zeng W.-C., Zhang W.-H, He Q., Shi B. | |
| Title | |
| Purification and characterization of a novel antioxidant peptide from bovine hair hydrolysates. Process Biochemistry, 50, 948-954, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@]1([H])CCCN1C(=O)[C@]([H])(CCCNC(N)=N)NC(=O)[C@]([H])(CCC(O)=O)NC(=O)[C@@]([H])(N)CS)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N[C@@H](CC1=CNC=N1)C(=O)N[C@@]([H])(CO)C(O)=O InChI=1S/C43H69N15O17S3/c1-19(60)32(57-39(71)29-5-3-11-58(29)41(73)24(4-2-10-48-43(45)46)52-34(66)22(6-8-30(61)62)50-33(65)21(44)15-76)40(72)56-28(17-78)38(70)55-27(16-77)37(69)51-23(7-9-31(63)64)35(67)53-25(12-20-13-47-18-49-20)36(68)54-26(14-59)42(74)75/h13,18-19,21-29,32,59-60,76-78H,2-12,14-17,44H2,1H3,(H,47,49)(H,50,65)(H,51,69)(H,52,66)(H,53,67)(H,54,68)(H,55,70)(H,56,72)(H,57,71)(H,61,62)(H,63,64)(H,74,75)(H4,45,46,48)/t19-,21+,22+,23+,24+,25+,26+,27+,28+,29+,32+/m1/s1 InChIKey: HZUDCMTWFVKHPN-IDYBEBGSSA-N |
| Database reference: |