BIOPEP-UWM: Report
| ID | 9491 |
| Name | DPP-III inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl peptidase-III (DPP-III) (EC 3.4.14.4) (MEROPS ID: M49.001) | |||
| Number of residues | 2 |
Activity code | dpp3 |
| Activity : | dipeptidyl peptidase III inhibitor |
|||
| Chemical mass | 273.3311 | Monoisotopic mass | 273.1796 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Dhanda S.; Singh H.; Singh J. | |
| Title | |
| Hydrolysis of various bioactive peptides by goat brain dipeptidylpeptidase-III. Cell Biochem. Funct. 23, 3, 339–345. | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C11H23N5O3/c1-6(2)8(10(18)19)16-9(17)7(12)4-3-5-15-11(13)14/h6-8H,3-5,12H2,1-2H3,(H,16,17)(H,18,19)(H4,13,14,15)/t7-,8-/m0/s1 InChIKey=DAQIJMOLTMGJLO-YUMQZZPRSA-N Information concerning Dipeptidyl peptidase-III (DPP-III) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: M49.001) Inhibitor of leucyltransferase (EC 2.3.2.6) according to the BRENDA database |
| Database reference: |
| BRENDA: Ligand Arg-Val ChEBI: ID 73823 ChemSpider: ID 5360779 EPA CompTox: ID DTXSID20426329 EPA DSSTox: ID DTXSID20426329 J-GLOBAL: ID 200907031576923328 Metabolights: ID MTBLC73823 Nikkaji: ID J36.191G PubChem: CID 6992654 SureChEMBL: ID SCHEMBL320944 ZINC: ID ZINC000001579827 |