BIOPEP-UWM: Report
| ID | 9494 |
| Name | DPP-III inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl peptidase-III (DPP-III) (EC 3.4.14.4) (MEROPS ID: M49.001) | |||
| Number of residues | 2 |
Activity code | dpp3 |
| Activity : | dipeptidyl peptidase III inhibitor |
|||
| Chemical mass | 283.3260 | Monoisotopic mass | 283.1640 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Dhanda S.; Singh H.; Singh J. | |
| Title | |
| Hydrolysis of various bioactive peptides by goat brain dipeptidylpeptidase-III. Cell Biochem. Funct. 23, 3, 339–345. | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[N]([H])C=N1)C(=O)N[C@@H](CCCCN)C(=O)O InChI=1S/C12H21N5O3/c13-4-2-1-3-10(12(19)20)17-11(18)9(14)5-8-6-15-7-16-8/h6-7,9-10H,1-5,13-14H2,(H,15,16)(H,17,18)(H,19,20)/t9-,10-/m0/s1 InChIKey=CZVQSYNVUHAILZ-UWVGGRQHSA-N Information concerning Dipeptidyl peptidase-III (DPP-III) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: M49.001) Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BIOPEP-UWM database of bioactive peptides (ID 7844) |
| Database reference: |
| AHTPDB: ID 3294, 3329, 3451, 3940, 6747 BioPepDB: ID biopep00456 BIOPEP-UWM database of bioactive peptides: ID 7844 ChEBI: ID 74052 ChemIDplus: ID 37700-85-9 ChemSpider: ID 130667 EPA DSSTox: ID DTXCID90113633 J-GLOBAL: ID 200907039227371610 Nikkaji: ID J150.402I PubChem: CID 148224 SATPdb: ID satpdb11845 ZINC: ID ZINC1589375 |