BIOPEP-UWM: Report
| ID | 9517 |
| Name | DPP-III inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl peptidase-III (DPP-III) (EC 3.4.14.4) (MEROPS ID: M49.001) | |||
| Number of residues | 4 |
Activity code | dpp3 |
| Activity : | dipeptidyl peptidase III inhibitor |
|||
| Chemical mass | 442.4640 | Monoisotopic mass | 442.1846 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Dhanda S.; Singh H.; Singh J. | |
| Title | |
| Hydrolysis of various bioactive peptides by goat brain dipeptidylpeptidase-III. Cell Biochem. Funct. 23, 3, 339–345, 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccc(O)cc1)C(=O)NCC(=O)NCC(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O InChI=1S/C22H26N4O6/c23-17(10-15-6-8-16(27)9-7-15)21(30)25-12-19(28)24-13-20(29)26-18(22(31)32)11-14-4-2-1-3-5-14/h1-9,17-18,27H,10-13,23H2,(H,24,28)(H,25,30)(H,26,29)(H,31,32)/t17-,18-/m0/s1 InChIKey=GYNQVPIDAQTZOY-ROUUACIJSA-N Information concerning Dipeptidyl peptidase-III (DPP-III) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: M49.001) Opioid peptide according to the ChEMBL database |
| Database reference: |
| ACToR: ID 60254-82-2 BRENDA: Ligand Enkephalin ChEMBL: ID CHEMBL3250189 ChemIDplus: ID 60254-82-2 ChemSpider: ID 4956282 CTD: ID 60254-82-2 J-GLOBAL: ID 200907010523623279 Nikkaji: ID J293.205I PepBank: Peptide YGGF PubChem: CID 6453937 SureChEMBL: ID SCHEMBL9052245 ZINC: ID ZINC000013538065 |