BIOPEP-UWM: Report
| ID | 9518 |
| Name | DPP-III inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl peptidase-III (DPP-III) (EC 3.4.14.4) (MEROPS ID: M49.001) | |||
| Number of residues | 4 |
Activity code | dpp3 |
| Activity : | dipeptidyl peptidase III inhibitor |
|||
| Chemical mass | 597.6822 | Monoisotopic mass | 597.2249 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Dhanda S.; Singh H.; Singh J. | |
| Title | |
| Hydrolysis of various bioactive peptides by goat brain dipeptidylpeptidase-III. Cell Biochem. Funct. 23, 3, 339–345, 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCSC)(NC(=O)[C@@H](N)CC1=CNC2=CC=CC=C12)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(CC1=CC=CC=C1)C(O)=O InChI=1S/C29H35N5O7S/c1-42-12-11-22(32-26(37)20(30)14-18-16-31-21-10-6-5-9-19(18)21)27(38)33-23(15-25(35)36)28(39)34-24(29(40)41)13-17-7-3-2-4-8-17/h2-10,16,20,22-24,31H,11-15,30H2,1H3,(H,32,37)(H,33,38)(H,34,39)(H,35,36)(H,40,41)/t20-,22-,23-,24-/m0/s1 InChIKey=IMBSBQAIIXMNSC-BIHRQFPBSA-N Information concerning Dipeptidyl peptidase-III (DPP-III) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: M49.001) |
| Database reference: |
| ChemSpider: ID 8116821 EROP-Moscow: ID E00206 PepBank: Peptide WMDF PubChem: CID 9941203 SureChEMBL: ID SCHEMBL3230519 |