BIOPEP-UWM: Report
| ID | 9523 |
| Name | DPP-III inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl peptidase-III (DPP-III) (EC 3.4.14.4) (MEROPS ID: M49.001) | |||
| Number of residues | 5 |
Activity code | dpp3 |
| Activity : | dipeptidyl peptidase III inhibitor |
|||
| Chemical mass | 751.9374 | Monoisotopic mass | 751.3828 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Abramic, M.; Schleuder, D.; Dolovcak, L.; Schroder, W.; Strupat, K.; Sagi, D.; Peter-Katalinic, J.; Vitale, L. | |
| Title | |
| Human and rat dipeptidyl peptidase III, biochemical and mass spectrometric arguments for similarities and differences. Biol. Chem., 381, 1233–1243, 2000 | |
| Year | Source |
| 2000 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC(C)C)C(=O)N[C@@H](CC1=C[N]([H])C2=CC=CC=C12)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)O InChI=1S/C37H53N9O6S/c1-22(2)18-26(38)32(47)45-30(20-24-21-42-27-13-8-7-12-25(24)27)35(50)44-29(15-17-53-3)34(49)43-28(14-9-16-41-37(39)40)33(48)46-31(36(51)52)19-23-10-5-4-6-11-23/h4-8,10-13,21-22,26,28-31,42H,9,14-20,38H2,1-3H3,(H,43,49)(H,44,50)(H,45,47)(H,46,48)(H,51,52)(H4,39,40,41)/t26-,28-,29-,30-,31-/m0/s1 InChIKey=XBXACJKRWWOWLI-PZBSVLGOSA-N Information concerning Dipeptidyl peptidase-III (DPP-III) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: M49.001) |
| Database reference: |
| BRENDA: Ligand Leu-Trp-Met-Arg-Phe PepBank: Peptide LWMRF PubChem: CID 18392838 SureChEMBL: ID SCHEMBL6235382 ZINC: ID ZINC150340204 |