BIOPEP-UWM: Report
| ID | 9524 |
| Name | DPP-III inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl peptidase-III (DPP-III) (EC 3.4.14.4) (MEROPS ID: M49.001) | |||
| Number of residues | 5 |
Activity code | dpp3 |
| Activity : | dipeptidyl peptidase III inhibitor |
|||
| Chemical mass | 618.8056 | Monoisotopic mass | 618.4092 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Abramic, M.; Schleuder, D.; Dolovcak, L.; Schroder, W.; Strupat, K.; Sagi, D.; Peter-Katalinic, J.; Vitale, L. | |
| Title | |
| Human and rat dipeptidyl peptidase III, biochemical and mass spectrometric arguments for similarities and differences. Biol. Chem., 381, 1233–1243, 2000 | |
| Year | Source |
| 2000 | Journal |
| Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O InChI=1S/C32H54N6O6/c1-7-21(6)27(38-30(41)26(20(4)5)37-28(39)23(34)15-11-12-16-33)31(42)35-24(17-19(2)3)29(40)36-25(32(43)44)18-22-13-9-8-10-14-22/h8-10,13-14,19-21,23-27H,7,11-12,15-18,33-34H2,1-6H3,(H,35,42)(H,36,40)(H,37,39)(H,38,41)(H,43,44)/t21-,23-,24-,25-,26-,27-/m0/s1 InChIKey=YQRGAHAXSPQKMR-BLECARSGSA-N Information concerning Dipeptidyl peptidase-III (DPP-III) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: M49.001) |
| Database reference: |
| BRENDA: Ligand Lys-Val-Ile-Leu-Phe J-Global: ID 200907009666599249 Nikkaji: ID J394.114K PubChem: CID 92043939 ZINC: ID ZINC100077188 |