BIOPEP-UWM: Report
| ID | 9531 |
| Name | Antioxidant peptide from feather keratin hydrolysates |
| sequence |
| Function: | |||
| Antioxidant peptide | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 848.9908 | Monoisotopic mass | 848.3621 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wan M.-Y., Dong G., Yang, B.-Q. & Feng H. | |
| Title | |
| Identification and characterization of a novel antioxidant peptide from feather keratin hydrolysate. Biotechnology Letters, 38(4), 643–649, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CS)C(=O)NCC(=O)O InChI=1/C32H56N12O11S2/c1-15(2)9-18(41-28(52)19(10-23(34)46)40-25(49)16(33)12-45)27(51)42-21(14-57)29(53)39-17(5-3-7-37-32(35)36)31(55)44-8-4-6-22(44)30(54)43-20(13-56)26(50)38-11-24(47)48/h15-22,45,56-57H,3-14,33H2,1-2H3,(H2,34,46)(H,38,50)(H,39,53)(H,40,49)(H,41,52)(H,42,51)(H,43,54)(H,47,48)(H4,35,36,37)/t16-,17-,18-,19-,20-,21-,22-/s2 InChIKey=RADNVMWWTSCLOV-IOZKKPQINA-N |
| Database reference: |