BIOPEP-UWM: Report
| ID | 9532 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 973.9812 | Monoisotopic mass | 973.4450 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Orsini Delgado M. C., Nardo A., Pavlovic M., Rogniaux H., Añón M. C., Tironi V. A. | |
| Title | |
| Identification and characterization of antioxidant peptides obtained by gastrointestinal digestion of amaranth proteins. Food Chem., 197, 1160-1167, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C38H63N13O17/c1-16(2)13-18(39)31(61)47-19(6-9-25(40)52)32(62)45-17(3)30(60)46-21(8-11-27(54)55)33(63)48-20(7-10-26(41)53)34(64)50-24(15-29(58)59)36(66)51-23(14-28(56)57)35(65)49-22(37(67)68)5-4-12-44-38(42)43/h16-24H,4-15,39H2,1-3H3,(H2,40,52)(H2,41,53)(H,45,62)(H,46,60)(H,47,61)(H,48,63)(H,49,65)(H,50,64)(H,51,66)(H,54,55)(H,56,57)(H,58,59)(H,67,68)(H4,42,43,44)/t17-,18-,19-,20-,21-,22-,23-,24-/m0/s1 InChIKey: VCKNYBZVWLWGSA-OPKHLUCYSA-N |
| Database reference: |