BIOPEP-UWM: Report
| ID | 9540 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 6 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 682.8461 | Monoisotopic mass | 682.4251 | |
| IC50 : | 105.44 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Chen R., Chen X., Zeng Z., Ma H., Chen S. | |
| Title | |
| Dipeptidyl peptidase IV-inhibitory peptides derived from silver carp (Hypophthalmichthys molitrix Val.) proteins. J. Agric. Food Chem., 64, 831-839, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N1CCC[C@@]1([H])C(=O)NCC(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(O)=O)C(O)=O InChI=1S/C33H58N6O9/c1-9-18(6)25(30(44)35-22(16-24(40)41)28(42)38-27(33(47)48)20(8)11-3)37-31(45)26(19(7)10-2)36-29(43)23-13-12-14-39(23)32(46)21(34)15-17(4)5/h17-23,25-27H,9-16,34H2,1-8H3,(H,35,44)(H,36,43)(H,37,45)(H,38,42)(H,40,41)(H,47,48)/t18-,19-,20-,21-,22-,23-,25-,26-,27-/m0/s1 InChIKey= PNMORPFFFCHACT-ATQATTBRSA-N |
| Database reference: |