BIOPEP-UWM: Report
| ID | 9541 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 7 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 565.6177 | Monoisotopic mass | 565.2851 | |
| IC50 : | 105.44 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Chen R., Chen X., Zeng Z., Ma H., Chen S. | |
| Title | |
| Dipeptidyl peptidase IV-inhibitory peptides derived from silver carp (Hypophthalmichthys molitrix Val.) proteins. J. Agric. Food Chem., 64, 831-839, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C25H39N7O8/c1-14(26)24(38)32-11-4-6-16(32)22(36)28-13-19(33)30-9-3-7-17(30)23(37)29-15(2)21(35)27-12-20(34)31-10-5-8-18(31)25(39)40/h14-18H,3-13,26H2,1-2H3,(H,27,35)(H,28,36)(H,29,37)(H,39,40)/t14-,15-,16-,17-,18-/m0/s1 InChIKey= YLHGGIUFFQYKSL-ATIWLJMLSA-N |
| Database reference: |