BIOPEP-UWM: Report
| ID | 9542 |
| Name | Anticancer peptide |
| sequence |
| Function: | |||
| Anticancer | |||
| Number of residues | 3 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 402.4432 | Monoisotopic mass | 402.1897 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang L., Zhang J., Yuan Q., Xie H., Shi J., Ju X. | |
| Title | |
| Separation and purification of an anti-tumor peptide from rapeseed (Brassica campestris L.) and the effect on cell apoptosis. Food Funct., 7, 2239-2248, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[N]([H])C2=CC=CC=C12)C(=O)N[C@@H]([C@H](O)C)C(=O)N3[C@@H](CCC3)C(=O)O InChI=1S/C20H26N4O5/c1-11(25)17(19(27)24-8-4-7-16(24)20(28)29)23-18(26)14(21)9-12-10-22-15-6-3-2-5-13(12)15/h2-3,5-6,10-11,14,16-17,22,25H,4,7-9,21H2,1H3,(H,23,26)(H,28,29)/t11-,14+,16+,17+/m1/s1 InChIKey= ZZDFLJFVSNQINX-UMPQAUOISA-N |
| Database reference: |