BIOPEP-UWM: Report
| ID | 9545 |
| Name | DPPIV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 7 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 721.9250 | Monoisotopic mass | 721.4723 | |
| IC50 : | 3.83 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ashok A., Aparna B. H. S. | |
| Title | |
| Discovery, synthesis, and in vitro evaluation of a novel bioactive peptide for ACE and DPP-IV inhibitory activity. Eur. J. Med. Chem., 180, 99-110, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)O InChI=1S/C36H63N7O8/c1-9-22(7)29(40-28(44)19-37)35(49)43-16-12-14-27(43)33(47)39-25(18-21(5)6)34(48)42-15-11-13-26(42)32(46)38-24(17-20(3)4)31(45)41-30(36(50)51)23(8)10-2/h20-27,29-30H,9-19,37H2,1-8H3,(H,38,46)(H,39,47)(H,40,44)(H,41,45)(H,50,51)/t22-,23-,24-,25-,26-,27-,29-,30-/m0/s1 InChIKey=MSHLQYRYTWUMNE-PXCFLYLPSA-N |
| Database reference: |