BIOPEP-UWM: Report
| ID | 9547 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 3 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 391.4602 | Monoisotopic mass | 391.2100 | |
| IC50 : | 3900.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Matsui T., Oki T., Osajima Y. | |
| Title | |
| Isolation and identification of peptidic α-glucosidase inhibitors derived from sardine muscle hydrolyzate. Z Naturforsch C 54:259–263 (1999) | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C20H29N3O5/c1-12(2)10-16(20(27)28)22-18(25)17-4-3-9-23(17)19(26)15(21)11-13-5-7-14(24)8-6-13/h5-8,12,15-17,24H,3-4,9-11,21H2,1-2H3,(H,22,25)(H,27,28)/t15-,16-,17-/m0/s1 InChIKey=BIWVVOHTKDLRMP-ULQDDVLXSA-N |
| Database reference: |