BIOPEP-UWM: Report
| ID | 9549 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 3 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 335.3542 | Monoisotopic mass | 335.1476 | |
| IC50 : | 5000.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Matsui T., Oki T., Osajima Y. | |
| Title | |
| Isolation and identification of peptidic α-glucosidase inhibitors derived from sardine muscle hydrolyzate. Z Naturforsch C 54:259–263 (1999) | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)O InChI=1S/C16H21N3O5/c17-12(8-10-3-5-11(20)6-4-10)16(24)19-7-1-2-13(19)15(23)18-9-14(21)22/h3-6,12-13,20H,1-2,7-9,17H2,(H,18,23)(H,21,22)/t12-,13-/m0/s1 InChIKey= SZEIFUXUTBBQFQ-STQMWFEESA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptide (ID 9066) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptide: ID 9066 |