BIOPEP-UWM: Report
| ID | 9550 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 3 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 441.4759 | Monoisotopic mass | 441.1893 | |
| IC50 : | 25800.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Matsui T., Oki T., Osajima Y. | |
| Title | |
| Isolation and identification of peptidic α-glucosidase inhibitors derived from sardine muscle hydrolyzate. Z Naturforsch C 54:259–263 (1999) | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O InChI=1S/C23H27N3O6/c24-18(12-14-3-7-16(27)8-4-14)22(30)26-11-1-2-20(26)21(29)25-19(23(31)32)13-15-5-9-17(28)10-6-15/h3-10,18-20,27-28H,1-2,11-13,24H2,(H,25,29)(H,31,32)/t18-,19-,20-/m0/s1 InChIKey=VPEFOFYNHBWFNQ-UFYCRDLUSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8617) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 8617 ChemSpider: ID 393564 MMDB: ID 24563.2, 24563 PubChem: CID 446125 |