BIOPEP-UWM: Report
| ID | 9555 |
| Name | Antioxidant peptide from hydrolysate of blue-spotted stingray |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 661.7462 | Monoisotopic mass | 661.3214 | |
| EC50 : | 12.60 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fai-Chu Wong, Jianbo Xiao, Michelle G-Ling Ong, Mei-Jing Pang, Shao-Jun Wong, Lai-Kuan Teh, Tsun-Thai Chai | |
| Title | |
| Identification and characterization of antioxidant peptides from hydrolysate of blue-spotted stingray and their stability against thermal, pH and simulated gastrointestinal digestion treatments. Food Chem, 271 (15), 614-622, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)[C@]1([H])CCCN1C(=O)[C@]([H])(C)NC(=O)[C@]([H])(CC1=CC=CC=C1)NC(=O)[C@]([H])(C)NC(=O)[C@@H](N)CC1=CNC2=CC=CC=C12)C(O)=O InChI=1S/C34H43N7O7/c1-19(37-30(43)25(35)17-23-18-36-26-13-8-7-12-24(23)26)29(42)40-27(16-22-10-5-4-6-11-22)31(44)38-20(2)33(46)41-15-9-14-28(41)32(45)39-21(3)34(47)48/h4-8,10-13,18-21,25,27-28,36H,9,14-17,35H2,1-3H3,(H,37,43)(H,38,44)(H,39,45)(H,40,42)(H,47,48)/t19-,20-,21-,25-,27-,28-/m0/s1 InChIKey=RRNCDHZEWHGBBL-IWYJPSTGSA-N |
| Database reference: |