BIOPEP-UWM: Report
| ID | 9558 |
| Name | Antioxidant peptide from hydrolysate of blue-spotted stingray |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 650.7859 | Monoisotopic mass | 650.3087 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fai-Chu Wong, Jianbo Xiao, Michelle G-Ling Ong, Mei-Jing Pang, Shao-Jun Wong, Lai-Kuan Teh, Tsun-Thai Chai | |
| Title | |
| Identification and characterization of antioxidant peptides from hydrolysate of blue-spotted stingray and their stability against thermal, pH and simulated gastrointestinal digestion treatments. Food Chem, 271 (15), 614-622, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCSC)C(=O)N[C@@]([H])(CC1=CC=C(O)C=C1)C(=O)N1CCC[C@@]1([H])C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(O)=O InChI=1S/C30H46N6O8S/c1-17(2)14-22(27(40)33-18(3)30(43)44)34-25(38)16-32-28(41)24-6-5-12-36(24)29(42)23(15-19-7-9-20(37)10-8-19)35-26(39)21(31)11-13-45-4/h7-10,17-18,21-24,37H,5-6,11-16,31H2,1-4H3,(H,32,41)(H,33,40)(H,34,38)(H,35,39)(H,43,44)/t18-,21-,22-,23-,24-/m0/s1 InChIKey=PYKFBNRYVHMOEZ-NHKCCNDQSA-N |
| Database reference: |