BIOPEP-UWM: Report
| ID | 9559 |
| Name | antioxidative |
| sequence |
| Function: | |||
| antioxidative | |||
| Number of residues | 11 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1337.4346 | Monoisotopic mass | 1336.6714 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gupta A., Mann B., Kumar R., Sangwan R.B., | |
| Title | |
| Identification of antioxidant peptides in cheddar cheese made with adjunct culture Lactobacillus casei ssp. casei 300. Milchwissenschaft, 2010, 65(4), 396-399. | |
| Year | Source |
| 2010 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(CC)[C@]([H])(NC(=O)[C@@H](N)CC1=CNC=N1)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(C(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N[C@@]([H])(CCCNC(N)=N)C(O)=O InChI=1S/C56H92N18O20/c1-5-28(4)44(73-45(83)30(58)22-29-24-62-26-64-29)53(91)68-32(13-16-39(59)76)47(85)65-31(10-6-7-19-57)46(84)66-34(15-18-41(79)80)49(87)70-36(23-42(81)82)50(88)72-43(27(2)3)54(92)74-21-9-12-38(74)52(90)71-37(25-75)51(89)67-33(14-17-40(77)78)48(86)69-35(55(93)94)11-8-20-63-56(60)61/h24,26-28,30-38,43-44,75H,5-23,25,57-58H2,1-4H3,(H2,59,76)(H,62,64)(H,65,85)(H,66,84)(H,67,89)(H,68,91)(H,69,86)(H,70,87)(H,71,90)(H,72,88)(H,73,83)(H,77,78)(H,79,80)(H,81,82)(H,93,94)(H4,60,61,63)/t28-,30-,31-,32-,33-,34-,35-,36-,37-,38-,43-,44-/m0/s1 InChIKey: ZVYGFUKOHQGXSX-UEKIRPJUSA-N Predicted ligand of Thrombin (EC 3.4.21.5) (MEROPS ID: S01.217) (PDB code: 2BVR) according to the BIOPEP-UWM Virtual database |
| Database reference: |
| BIOPEP-UWM Virtual database: ID 206 DFBP: ID DFBPANTH0148 |