BIOPEP-UWM: Report
| ID | 9563 |
| Name | Copper binding peptide |
| sequence |
| Function: | |||
| Copper binding | |||
| Number of residues | 5 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 702.8029 | Monoisotopic mass | 702.3915 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kotynia A., Krzyżak E., Kamysz E., Sobocińska M., Brasuń J. | |
| Title | |
| The coordination abilities of three novel analogues of saliva peptides: The influence of structural modification on the copper binding. Int. J. Pept. Res. Therapeut., 23, 409-418, 2017 | |
| Year | Source |
| 2017 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C31H50N12O7/c32-19(12-13-24(33)44)25(45)40-20(9-4-14-38-30(34)35)26(46)42-22(17-18-7-2-1-3-8-18)28(48)43-16-6-11-23(43)27(47)41-21(29(49)50)10-5-15-39-31(36)37/h1-3,7-8,19-23H,4-6,9-17,32H2,(H2,33,44)(H,40,45)(H,41,47)(H,42,46)(H,49,50)(H4,34,35,38)(H4,36,37,39)/t19-,20-,21-,22-,23-/m0/s1 InChIKey= GATLZJDTIJWHFY-VUBDRERZSA-N |
| Database reference: |