BIOPEP-UWM: Report
| ID | 9589 |
| Name | HMG-CoA reductase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of HMG-CoA reductase (EC 1.1.1.34) | |||
| Number of residues | 7 |
Activity code | HMGi |
| Activity : | HMG-CoA reductase inhibitor |
|||
| Chemical mass | 785.8385 | Monoisotopic mass | 785.3583 | |
| IC50 : | 0.26 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pak V. V., Koo M., Kwon D. Y., Yun L. | |
| Title | |
| Design of a highly potent inhibitory peptide acting as a competitive inhibitor of HMG-CoA reductase. Amino Acids, 43, 2015-2025, 2012 | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)NCC(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C37H51N7O12/c1-19(2)31(36(54)40-20(3)32(50)42-25(37(55)56)14-15-29(48)49)44-34(52)27(17-23-10-12-24(46)13-11-23)41-28(47)18-39-33(51)26(16-22-8-6-5-7-9-22)43-35(53)30(38)21(4)45/h5-13,19-21,25-27,30-31,45-46H,14-18,38H2,1-4H3,(H,39,51)(H,40,54)(H,41,47)(H,42,50)(H,43,53)(H,44,52)(H,48,49)(H,55,56)/t20-,21+,25-,26-,27-,30-,31-/m0/s1 InChIKey: FVPWAQRXBMRBON-RFPQHJJASA-N HMG-CoA reductase (EC 1.1.1.34) is involved in cholesterol biosynthesis. |
| Database reference: |