BIOPEP-UWM: Report
| ID | 9593 |
| Name | antifungal peptide |
| sequence |
| Function: | |||
| candidacidal | |||
| Number of residues | 7 |
Activity code | af |
| Activity : | antifungal |
|||
| Chemical mass | 835.8591 | Monoisotopic mass | 835.3812 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Polonelli L., Pontón J., Elguezabal N., Moragues M.D., Casoli C., Pilotti E., Ronzi P., Dobroff A.S., Rodrigues E.G., Juliano M.A., Maffei D.L., et al | |
| Title | |
| Antibody Complementarity-Determining Regions (CDRs) Can Display Differential Antimicrobial, Antiviral and Antitumor Activities. PLoS One. 3(6): e2371. 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[N]([H])C2=CC=CC=C12)C(=O)N[C@@H](C)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@H](O)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CO)C(=O)O InChI= 1S/C35H53N11O13/c1-16(41-29(53)20(36)12-18-13-40-21-7-4-3-6-19(18)21)28(52)44-24(14-47)32(56)46-27(17(2)49)33(57)43-22(8-5-11-39-35(37)38)30(54)42-23(9-10-26(50)51)31(55)45-25(15-48)34(58)59/h3-4,6-7,13,16-17,20,22-25,27,40,47-49H,5,8-12,14-15,36H2,1-2H3,(H,41,53)(H,42,54)(H,43,57)(H,44,52)(H,45,55)(H,46,56)(H,50,51)(H,58,59)(H4,37,38,39)/t16-,17+,20-,22-,23-,24-,25-,27-/m0/s1 InChIKey: XCHHMKAIBZMRMD-UVTBSBKMSA-N Antiviral peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9643) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9643 |