BIOPEP-UWM: Report
| ID | 9599 |
| Name | antifungal peptide |
| sequence |
| Function: | |||
| candidacidal | |||
| Number of residues | 11 |
Activity code | af |
| Activity : | antifungal |
|||
| Chemical mass | 1117.2382 | Monoisotopic mass | 1116.5442 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Polonelli L., Pontón J., Elguezabal N.,Moragues M.D., Casoli C., Pilotti E., Ronzi P., Dobroff A.S., Rodrigues E.G., Juliano M.A., Maffei D.L., Magl | |
| Title | |
| Antibody Complementarity-Determining Regions (CDRs) Can Display Differential Antimicrobial, Antiviral and Antitumor Activities. PLoS One. 3(6): e2371. 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)NCC(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)NCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O InChI= 1S/C43H76N18O15S/c1-20(2)33(61-31(65)19-54-37(71)25(10-11-28(45)62)58-38(72)24(56-34(68)21(3)44)9-7-14-51-43(48)49)40(74)59-23(8-6-13-50-42(46)47)36(70)53-17-29(63)52-18-30(64)55-22(4)35(69)57-26(12-15-77-5)39(73)60-27(41(75)76)16-32(66)67/h20-27,33H,6-19,44H2,1-5H3,(H2,45,62)(H,52,63)(H,53,70)(H,54,71)(H,55,64)(H,56,68)(H,57,69)(H,58,72)(H,59,74)(H,60,73)(H,61,65)(H,66,67)(H,75,76)(H4,46,47,50)(H4,48,49,51)/t21-,22-,23-,24-,25-,26-,27-,33-/m0/s1 InChIKey: IRXZQFJHJNXXPH-QGSRLWRXSA-N |
| Database reference: |