BIOPEP-UWM: Report
| ID | 9601 |
| Name | antifungal peptide |
| sequence |
| Function: | |||
| candidacidal | |||
| Number of residues | 7 |
Activity code | af |
| Activity : | antifungal |
|||
| Chemical mass | 760.8306 | Monoisotopic mass | 760.3953 | |
| EC50 : | 11.96 µM |
|||
| Bibliographic data: | |
| Authors | |
| Polonelli L., Pontón J., Elguezabal N.,Moragues M.D., Casoli C., Pilotti E., Ronzi P., Dobroff A.S., Rodrigues E.G., Juliano M.A., Maffei D.L., Magl | |
| Title | |
| Antibody Complementarity-Determining Regions (CDRs) Can Display Differential Antimicrobial, Antiviral and Antitumor Activities. PLoS One. 3(6): e2371. 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C32H56N8O13/c1-14(2)9-17(33)26(46)40-25(16(5)6)31(51)38-21(12-41)30(50)37-20(11-23(34)43)29(49)36-19(10-15(3)4)28(48)35-18(7-8-24(44)45)27(47)39-22(13-42)32(52)53/h14-22,25,41-42H,7-13,33H2,1-6H3,(H2,34,43)(H,35,48)(H,36,49)(H,37,50)(H,38,51)(H,39,47)(H,40,46)(H,44,45)(H,52,53)/t17-,18-,19-,20-,21-,22-,25-/m0/s1 InChIKey: KSIGCLZGNMZTRT-FGIKLMJHSA-N |
| Database reference: |