BIOPEP-UWM: Report
| ID | 9605 |
| Name | HMG-CoA reductase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of HMG-CoA reductase (EC 1.1.1.34) | |||
| Number of residues | 4 |
Activity code | HMGi |
| Activity : | HMG-CoA reductase inhibitor |
|||
| Chemical mass | 488.5751 | Monoisotopic mass | 488.2626 | |
| IC50 : | 484.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kwon D. Y., Oh S. W., Lee J. S., Yang H. J., Lee S. H., Lee J. H., Lee Y. B., Sohn H. S. | |
| Title | |
| Amino acid substitution of hypocholesterolemic peptides originated from glycinin hydrolyzate. Food Sci. Biotechnol., 11, 55–61, 2002 | |
| Year | Source |
| 2002 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C25H36N4O6/c1-15(2)13-18(26)23(32)28-11-3-5-20(28)22(31)27-19(14-16-7-9-17(30)10-8-16)24(33)29-12-4-6-21(29)25(34)35/h7-10,15,18-21,30H,3-6,11-14,26H2,1-2H3,(H,27,31)(H,34,35)/t18-,19-,20-,21-/m0/s1 InChIKey: NRJZAOVJHXKFRI-TUFLPTIASA-N HMG-CoA reductase (EC 1.1.1.34) is involved in cholesterol biosynthesis. |
| Database reference: |
| BindingDB: ID 50226159 BRENDA: Ligand LPYP ChEMBL: ID CHEMBL412060 ChemSpider: ID 23319380 EPA CompTox: ID DTXSID90659167 EPA DSSTox: ID DTXCID00609916 J-GLOBAL: ID 201707003233025250 Nikkaji: ID J3.595.388D PubChem: CID 44451976 |