BIOPEP-UWM: Report
| ID | 9608 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Inhibitor of HIV-1 replication | |||
| Number of residues | 11 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 1168.2539 | Monoisotopic mass | 1167.5865 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Polonelli L., Pontón J., Elguezabal N.,Moragues M.D., Casoli C., Pilotti E., Ronzi P., Dobroff A.S., Rodrigues E.G., Juliano M.A., et al. | |
| Title | |
| Antibody Complementarity-Determining Regions (CDRs) Can Display Differential Antimicrobial, Antiviral and Antitumor Activities. PLoS One. 3(6): e2371. 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C49H81N15O18/c1-22(2)16-30(41(74)56-25(6)48(81)82)58-42(75)31(17-26-9-11-27(69)12-10-26)59-44(77)33(19-66)62-45(78)34(20-67)63-47(80)37(23(3)4)64-46(79)35(21-68)61-40(73)29(13-14-36(51)70)57-43(76)32(18-65)60-38(71)24(5)55-39(72)28(50)8-7-15-54-49(52)53/h9-12,22-25,28-35,37,65-69H,7-8,13-21,50H2,1-6H3,(H2,51,70)(H,55,72)(H,56,74)(H,57,76)(H,58,75)(H,59,77)(H,60,71)(H,61,73)(H,62,78)(H,63,80)(H,64,79)(H,81,82)(H4,52,53,54)/t24-,25-,28-,29-,30-,31-,32-,33-,34-,35-,37-/m0/s1 InChIKey: IUFWRQNTZSUVBZ-UNRZWHKVSA-N |
| Database reference: |