BIOPEP-UWM: Report
| ID | 9610 |
| Name | antifungal peptide |
| sequence |
| Function: | |||
| candidacidal | |||
| Number of residues | 9 |
Activity code | af |
| Activity : | antifungal |
|||
| Chemical mass | 1158.2244 | Monoisotopic mass | 1157.5674 | |
| EC50 : | 5.11 µM |
|||
| Bibliographic data: | |
| Authors | |
| Polonelli L., Pontón J., Elguezabal N.,Moragues M.D., Casoli C., Pilotti E., Ronzi P., Dobroff A.S., Rodrigues E.G., Juliano M.A. et al. | |
| Title | |
| Antibody Complementarity-Determining Regions (CDRs) Can Display Differential Antimicrobial, Antiviral and Antitumor Activities. PLoS One. 3(6): e2371. 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCC(N)=O)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@H](CC1=CNC2=CC=CC=C12)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CO)C(O)=O InChI=1S/C48H75N19O15/c49-25(11-13-35(50)70)38(73)60-29(12-14-36(51)71)41(76)61-27(8-3-15-57-47(53)54)39(74)65-32(21-68)43(78)63-30(19-37(52)72)42(77)64-31(18-23-20-59-26-7-2-1-6-24(23)26)45(80)67-17-5-10-34(67)44(79)62-28(9-4-16-58-48(55)56)40(75)66-33(22-69)46(81)82/h1-2,6-7,20,25,27-34,59,68-69H,3-5,8-19,21-22,49H2,(H2,50,70)(H2,51,71)(H2,52,72)(H,60,73)(H,61,76)(H,62,79)(H,63,78)(H,64,77)(H,65,74)(H,66,75)(H,81,82)(H4,53,54,57)(H4,55,56,58)/t25-,27-,28-,29-,30-,31-,32-,33-,34-/m0/s1 InChIKey: MQBATAMCDZWZAZ-NTIAKZIUSA-N Antiviral peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9657) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9657 |