BIOPEP-UWM: Report
| ID | 9611 |
| Name | antifungal peptide |
| sequence |
| Function: | |||
| candidacidal | |||
| Number of residues | 5 |
Activity code | af |
| Activity : | antifungal |
|||
| Chemical mass | 653.6813 | Monoisotopic mass | 653.2800 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Polonelli L., Pontón J., Elguezabal N., Moragues M.D., Casoli C., Pilotti E., Ronzi P., Dobroff A.S., Rodrigues E.G., Juliano M.A., et al. | |
| Title | |
| Antibody Complementarity-Determining Regions (CDRs) Can Display Differential Antimicrobial, Antiviral and Antitumor Activities. PLoS One. 3(6): e2371. 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CO)C(=O)N[C@@]([H])(CC1=CC=C(O)C=C1)C(=O)N[C@]([H])(C(=O)N[C@@]([H])(CC1=CC=CC=C1)C(=O)N[C@@H](CC1=CNC=N1)C(O)=O)[C@@]([H])(C)O InChI=1S/C31H39N7O9/c1-17(40)26(38-29(44)24(35-27(42)22(32)15-39)12-19-7-9-21(41)10-8-19)30(45)36-23(11-18-5-3-2-4-6-18)28(43)37-25(31(46)47)13-20-14-33-16-34-20/h2-10,14,16-17,22-26,39-41H,11-13,15,32H2,1H3,(H,33,34)(H,35,42)(H,36,45)(H,37,43)(H,38,44)(H,46,47)/t17-,22+,23+,24+,25+,26+/m1/s1 InChIKey: PCACFXOPTIFHKJ-LEROROTBSA-N Antiviral peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9658) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9658 |