BIOPEP-UWM: Report
| ID | 9613 |
| Name | antifungal peptide |
| sequence |
| Function: | |||
| candidacidal | |||
| Number of residues | 12 |
Activity code | af |
| Activity : | antifungal |
|||
| Chemical mass | 1369.4268 | Monoisotopic mass | 1368.6386 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Polonelli L., Pontón J., Elguezabal N.,Moragues M.D., Casoli C., Pilotti E., Ronzi P., Dobroff A.S., Rodrigues E.G., Juliano M.A., Maffei D.L., Magl | |
| Title | |
| Antibody Complementarity-Determining Regions (CDRs) Can Display Differential Antimicrobial, Antiviral and Antitumor Activities. PLoS One. 3(6): e2371. 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O InChI=1S/C58H92N14O24/c1-8-26(4)44(54(91)66-36(23-42(83)84)51(88)63-34(17-19-40(79)80)48(85)65-35(22-41(81)82)52(89)67-37(58(95)96)21-30-12-14-31(76)15-13-30)69-49(86)32(11-9-10-20-59)64-55(92)45(27(5)73)71-53(90)43(25(2)3)68-56(93)47(29(7)75)72-57(94)46(28(6)74)70-50(87)33(16-18-38(61)77)62-39(78)24-60/h12-15,25-29,32-37,43-47,73-76H,8-11,16-24,59-60H2,1-7H3,(H2,61,77)(H,62,78)(H,63,88)(H,64,92)(H,65,85)(H,66,91)(H,67,89)(H,68,93)(H,69,86)(H,70,87)(H,71,90)(H,72,94)(H,79,80)(H,81,82)(H,83,84)(H,95,96)/t26-,27+,28+,29+,32-,33-,34-,35-,36-,37-,43-,44-,45-,46-,47-/m0/s1 InChIKey: XITSOTIBOAQZMG-IIBZTXSASA-N Antiviral peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9659) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9659 |